C22H27N3O3 — CID 10714877
3-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]-1,3-benzoxazol-2-one (PubChem CID 10714877) has the molecular formula C22H27N3O3 and a molecular weight of 381.48 g/mol. Its IUPAC name is 3-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]-1,3-benzoxazol-2-one.
| Compound Name | 3-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 10714877 |
| Molecular Formula | C22H27N3O3 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | 3-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]-1,3-benzoxazol-2-one |
| SMILES | COc1ccccc1N1CCN(CCCCn2c(=O)oc3ccccc32)CC1 |
| InChI | InChI=1S/C22H27N3O3/c1-27-20-10-4-2-8-18(20)24-16-14-23(15-17-24)12-6-7-13-25-19-9-3-5-11-21(19)28-22(25)26/h2-5,8-11H,6-7,12-17H2,1H3 |
| InChIKey | LYFIWEIPIISOAR-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 50.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|