C20H29FN4O3 — CID 54755411
1-(2-(18F)fluoroethyl)-3-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]imidazolidine-2,4-dione (PubChem CID 54755411) has the molecular formula C20H29FN4O3 and a molecular weight of 391.48 g/mol. Its IUPAC name is 1-(2-(18F)fluoroethyl)-3-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]imidazolidine-2,4-dione.
| Compound Name | 1-(2-(18F)fluoroethyl)-3-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 54755411 |
| Molecular Formula | C20H29FN4O3 |
| Molecular Weight | 391.48 g/mol |
| Exact Mass | 391.22 |
| IUPAC Name | 1-(2-(18F)fluoroethyl)-3-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]imidazolidine-2,4-dione |
| SMILES | COc1ccccc1N1CCN(CCCCN2C(=O)CN(CC[18F])C2=O)CC1 |
| InChI | InChI=1S/C20H29FN4O3/c1-28-18-7-3-2-6-17(18)23-14-12-22(13-15-23)9-4-5-10-25-19(26)16-24(11-8-21)20(25)27/h2-3,6-7H,4-5,8-16H2,1H3/i21-1 |
| InChIKey | QTGPLFAFLAAJLN-GJQNQZCXSA-N |
| XLogP | 1.83 |
| TPSA | 56.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.48 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|