C23H31Cl2N3O3 — CID 139612892
3-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]-2H-1,3-benzoxazin-4-one;dihydrochloride (PubChem CID 139612892) has the molecular formula C23H31Cl2N3O3 and a molecular weight of 468.43 g/mol. Its IUPAC name is 3-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]-2H-1,3-benzoxazin-4-one;dihydrochloride.
| Compound Name | 3-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]-2H-1,3-benzoxazin-4-one;dihydrochloride |
|---|---|
| PubChem CID | 139612892 |
| Molecular Formula | C23H31Cl2N3O3 |
| Molecular Weight | 468.43 g/mol |
| Exact Mass | 467.17 |
| IUPAC Name | 3-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]-2H-1,3-benzoxazin-4-one;dihydrochloride |
| SMILES | COc1ccccc1N1CCN(CCCCN2COc3ccccc3C2=O)CC1.Cl.Cl |
| InChI | InChI=1S/C23H29N3O3.2ClH/c1-28-22-11-5-3-9-20(22)25-16-14-24(15-17-25)12-6-7-13-26-18-29-21-10-4-2-8-19(21)23(26)27;;/h2-5,8-11H,6-7,12-18H2,1H3;2*1H |
| InChIKey | KHDXDHVWCJIVLV-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 45.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.43 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|