C26H43N3O2 — CID 139624835
1-[5-[4-(2-methoxyphenyl)piperazin-1-yl]pentyl]-4,4,6,6-tetramethylazepan-2-one (PubChem CID 139624835) has the molecular formula C26H43N3O2 and a molecular weight of 429.65 g/mol. Its IUPAC name is 1-[5-[4-(2-methoxyphenyl)piperazin-1-yl]pentyl]-4,4,6,6-tetramethylazepan-2-one.
| Compound Name | 1-[5-[4-(2-methoxyphenyl)piperazin-1-yl]pentyl]-4,4,6,6-tetramethylazepan-2-one |
|---|---|
| PubChem CID | 139624835 |
| Molecular Formula | C26H43N3O2 |
| Molecular Weight | 429.65 g/mol |
| Exact Mass | 429.34 |
| IUPAC Name | 1-[5-[4-(2-methoxyphenyl)piperazin-1-yl]pentyl]-4,4,6,6-tetramethylazepan-2-one |
| SMILES | COc1ccccc1N1CCN(CCCCCN2CC(C)(C)CC(C)(C)CC2=O)CC1 |
| InChI | InChI=1S/C26H43N3O2/c1-25(2)19-24(30)29(21-26(3,4)20-25)14-10-6-9-13-27-15-17-28(18-16-27)22-11-7-8-12-23(22)31-5/h7-8,11-12H,6,9-10,13-21H2,1-5H3 |
| InChIKey | CXCYCIURJCFIHC-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.65 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|