C20H27BrN2O4 — CID 22449662
ethyl 6-[1-(4-bromobutyl)-2,4-dioxoquinazolin-3-yl]hexanoate (PubChem CID 22449662) has the molecular formula C20H27BrN2O4 and a molecular weight of 439.35 g/mol. Its IUPAC name is ethyl 6-[1-(4-bromobutyl)-2,4-dioxoquinazolin-3-yl]hexanoate.
| Compound Name | ethyl 6-[1-(4-bromobutyl)-2,4-dioxoquinazolin-3-yl]hexanoate |
|---|---|
| PubChem CID | 22449662 |
| Molecular Formula | C20H27BrN2O4 |
| Molecular Weight | 439.35 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | ethyl 6-[1-(4-bromobutyl)-2,4-dioxoquinazolin-3-yl]hexanoate |
| SMILES | CCOC(=O)CCCCCn1c(=O)c2ccccc2n(CCCCBr)c1=O |
| InChI | InChI=1S/C20H27BrN2O4/c1-2-27-18(24)12-4-3-8-15-23-19(25)16-10-5-6-11-17(16)22(20(23)26)14-9-7-13-21/h5-6,10-11H,2-4,7-9,12-15H2,1H3 |
| InChIKey | GUVXSBYNSIWJKK-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 70.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.35 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|