C14H17N3O4 — CID 139690708
ethyl 2-[3-(2-aminoethyl)-2,4-dioxoquinazolin-1-yl]acetate (PubChem CID 139690708) has the molecular formula C14H17N3O4 and a molecular weight of 291.31 g/mol. Its IUPAC name is ethyl 2-[3-(2-aminoethyl)-2,4-dioxoquinazolin-1-yl]acetate.
| Compound Name | ethyl 2-[3-(2-aminoethyl)-2,4-dioxoquinazolin-1-yl]acetate |
|---|---|
| PubChem CID | 139690708 |
| Molecular Formula | C14H17N3O4 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | ethyl 2-[3-(2-aminoethyl)-2,4-dioxoquinazolin-1-yl]acetate |
| SMILES | CCOC(=O)Cn1c(=O)n(CCN)c(=O)c2ccccc21 |
| InChI | InChI=1S/C14H17N3O4/c1-2-21-12(18)9-17-11-6-4-3-5-10(11)13(19)16(8-7-15)14(17)20/h3-6H,2,7-9,15H2,1H3 |
| InChIKey | DLVJPZINMHQXCQ-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 96.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |