C18H16N2O4 — CID 154831058
methyl 2-(3-benzyl-2,4-dioxoquinazolin-1-yl)acetate (PubChem CID 154831058) has the molecular formula C18H16N2O4 and a molecular weight of 324.34 g/mol. Its IUPAC name is methyl 2-(3-benzyl-2,4-dioxoquinazolin-1-yl)acetate.
| Compound Name | methyl 2-(3-benzyl-2,4-dioxoquinazolin-1-yl)acetate |
|---|---|
| PubChem CID | 154831058 |
| Molecular Formula | C18H16N2O4 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | methyl 2-(3-benzyl-2,4-dioxoquinazolin-1-yl)acetate |
| SMILES | COC(=O)Cn1c(=O)n(Cc2ccccc2)c(=O)c2ccccc21 |
| InChI | InChI=1S/C18H16N2O4/c1-24-16(21)12-19-15-10-6-5-9-14(15)17(22)20(18(19)23)11-13-7-3-2-4-8-13/h2-10H,11-12H2,1H3 |
| InChIKey | CXZIWFPJPBZFBD-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 70.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |