C25H21ClN2O4 — CID 155322949
3-benzyl-1-[2-(3-chloro-4-ethoxyphenyl)-2-oxoethyl]quinazoline-2,4-dione (PubChem CID 155322949) has the molecular formula C25H21ClN2O4 and a molecular weight of 448.91 g/mol. Its IUPAC name is 3-benzyl-1-[2-(3-chloro-4-ethoxyphenyl)-2-oxoethyl]quinazoline-2,4-dione.
| Compound Name | 3-benzyl-1-[2-(3-chloro-4-ethoxyphenyl)-2-oxoethyl]quinazoline-2,4-dione |
|---|---|
| PubChem CID | 155322949 |
| Molecular Formula | C25H21ClN2O4 |
| Molecular Weight | 448.91 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | 3-benzyl-1-[2-(3-chloro-4-ethoxyphenyl)-2-oxoethyl]quinazoline-2,4-dione |
| SMILES | CCOc1ccc(C(=O)Cn2c(=O)n(Cc3ccccc3)c(=O)c3ccccc32)cc1Cl |
| InChI | InChI=1S/C25H21ClN2O4/c1-2-32-23-13-12-18(14-20(23)26)22(29)16-27-21-11-7-6-10-19(21)24(30)28(25(27)31)15-17-8-4-3-5-9-17/h3-14H,2,15-16H2,1H3 |
| InChIKey | WTEREULAAQJGMD-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 70.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.91 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |