C19H18N2O6 — CID 95914099
2-(3-benzyl-6,7-dimethoxy-2,4-dioxoquinazolin-1-yl)acetic acid (PubChem CID 95914099) has the molecular formula C19H18N2O6 and a molecular weight of 370.36 g/mol. Its IUPAC name is 2-(3-benzyl-6,7-dimethoxy-2,4-dioxoquinazolin-1-yl)acetic acid.
| Compound Name | 2-(3-benzyl-6,7-dimethoxy-2,4-dioxoquinazolin-1-yl)acetic acid |
|---|---|
| PubChem CID | 95914099 |
| Molecular Formula | C19H18N2O6 |
| Molecular Weight | 370.36 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | 2-(3-benzyl-6,7-dimethoxy-2,4-dioxoquinazolin-1-yl)acetic acid |
| SMILES | COc1cc2c(=O)n(Cc3ccccc3)c(=O)n(CC(=O)O)c2cc1OC |
| InChI | InChI=1S/C19H18N2O6/c1-26-15-8-13-14(9-16(15)27-2)20(11-17(22)23)19(25)21(18(13)24)10-12-6-4-3-5-7-12/h3-9H,10-11H2,1-2H3,(H,22,23) |
| InChIKey | UOBJFGUFDASBHB-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 99.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.36 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |