C26H24N2O5 — CID 15992644
6,7-dimethoxy-1-phenacyl-3-(2-phenylethyl)quinazoline-2,4-dione (PubChem CID 15992644) has the molecular formula C26H24N2O5 and a molecular weight of 444.49 g/mol. Its IUPAC name is 6,7-dimethoxy-1-phenacyl-3-(2-phenylethyl)quinazoline-2,4-dione.
| Compound Name | 6,7-dimethoxy-1-phenacyl-3-(2-phenylethyl)quinazoline-2,4-dione |
|---|---|
| PubChem CID | 15992644 |
| Molecular Formula | C26H24N2O5 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | 6,7-dimethoxy-1-phenacyl-3-(2-phenylethyl)quinazoline-2,4-dione |
| SMILES | COc1cc2c(=O)n(CCc3ccccc3)c(=O)n(CC(=O)c3ccccc3)c2cc1OC |
| InChI | InChI=1S/C26H24N2O5/c1-32-23-15-20-21(16-24(23)33-2)28(17-22(29)19-11-7-4-8-12-19)26(31)27(25(20)30)14-13-18-9-5-3-6-10-18/h3-12,15-16H,13-14,17H2,1-2H3 |
| InChIKey | OWSFJGVZEIFTLF-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 79.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |