C18H17N3O4 — CID 25130239
(2S)-2-amino-3-(3-benzyl-2,4-dioxoquinazolin-1-yl)propanoic acid (PubChem CID 25130239) has the molecular formula C18H17N3O4 and a molecular weight of 339.35 g/mol. Its IUPAC name is (2S)-2-amino-3-(3-benzyl-2,4-dioxoquinazolin-1-yl)propanoic acid.
| Compound Name | (2S)-2-amino-3-(3-benzyl-2,4-dioxoquinazolin-1-yl)propanoic acid |
|---|---|
| PubChem CID | 25130239 |
| Molecular Formula | C18H17N3O4 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | (2S)-2-amino-3-(3-benzyl-2,4-dioxoquinazolin-1-yl)propanoic acid |
| SMILES | N[C@@H](Cn1c(=O)n(Cc2ccccc2)c(=O)c2ccccc21)C(=O)O |
| InChI | InChI=1S/C18H17N3O4/c19-14(17(23)24)11-20-15-9-5-4-8-13(15)16(22)21(18(20)25)10-12-6-2-1-3-7-12/h1-9,14H,10-11,19H2,(H,23,24)/t14-/m0/s1 |
| InChIKey | YDCDZGUUHCTTTB-AWEZNQCLSA-N |
| XLogP | 0.62 |
| TPSA | 107.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |