C17H13NO4 — CID 54726736
1-benzyl-4-hydroxy-2-oxoquinoline-3-carboxylic acid (PubChem CID 54726736) has the molecular formula C17H13NO4 and a molecular weight of 295.29 g/mol. Its IUPAC name is 1-benzyl-4-hydroxy-2-oxoquinoline-3-carboxylic acid.
| Compound Name | 1-benzyl-4-hydroxy-2-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 54726736 |
| Molecular Formula | C17H13NO4 |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | 1-benzyl-4-hydroxy-2-oxoquinoline-3-carboxylic acid |
| SMILES | O=C(O)c1c(O)c2ccccc2n(Cc2ccccc2)c1=O |
| InChI | InChI=1S/C17H13NO4/c19-15-12-8-4-5-9-13(12)18(16(20)14(15)17(21)22)10-11-6-2-1-3-7-11/h1-9,19H,10H2,(H,21,22) |
| InChIKey | UCQBLCMUHNLJLR-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |