C19H16N2O7 — CID 54685179
2-[(1-benzyl-4,6,7-trihydroxy-2-oxoquinoline-3-carbonyl)amino]acetic acid (PubChem CID 54685179) has the molecular formula C19H16N2O7 and a molecular weight of 384.34 g/mol. Its IUPAC name is 2-[(1-benzyl-4,6,7-trihydroxy-2-oxoquinoline-3-carbonyl)amino]acetic acid.
| Compound Name | 2-[(1-benzyl-4,6,7-trihydroxy-2-oxoquinoline-3-carbonyl)amino]acetic acid |
|---|---|
| PubChem CID | 54685179 |
| Molecular Formula | C19H16N2O7 |
| Molecular Weight | 384.34 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | 2-[(1-benzyl-4,6,7-trihydroxy-2-oxoquinoline-3-carbonyl)amino]acetic acid |
| SMILES | O=C(O)CNC(=O)c1c(O)c2cc(O)c(O)cc2n(Cc2ccccc2)c1=O |
| InChI | InChI=1S/C19H16N2O7/c22-13-6-11-12(7-14(13)23)21(9-10-4-2-1-3-5-10)19(28)16(17(11)26)18(27)20-8-15(24)25/h1-7,22-23,26H,8-9H2,(H,20,27)(H,24,25) |
| InChIKey | RXCNQDRMCXLIJX-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 149.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.34 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|