C24H17N3O3S — CID 54712910
N-(1,3-benzothiazol-2-yl)-1-benzyl-4-hydroxy-2-oxoquinoline-3-carboxamide (PubChem CID 54712910) has the molecular formula C24H17N3O3S and a molecular weight of 427.49 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-1-benzyl-4-hydroxy-2-oxoquinoline-3-carboxamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-1-benzyl-4-hydroxy-2-oxoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 54712910 |
| Molecular Formula | C24H17N3O3S |
| Molecular Weight | 427.49 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-1-benzyl-4-hydroxy-2-oxoquinoline-3-carboxamide |
| SMILES | O=C(Nc1nc2ccccc2s1)c1c(O)c2ccccc2n(Cc2ccccc2)c1=O |
| InChI | InChI=1S/C24H17N3O3S/c28-21-16-10-4-6-12-18(16)27(14-15-8-2-1-3-9-15)23(30)20(21)22(29)26-24-25-17-11-5-7-13-19(17)31-24/h1-13,28H,14H2,(H,25,26,29) |
| InChIKey | UDAOUOYTDMADRZ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.49 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |