C18H14FNO4 — CID 54679961
1-[(4-fluorophenyl)methyl]-4-hydroxy-6-methyl-2-oxoquinoline-3-carboxylic acid (PubChem CID 54679961) has the molecular formula C18H14FNO4 and a molecular weight of 327.31 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-4-hydroxy-6-methyl-2-oxoquinoline-3-carboxylic acid.
| Compound Name | 1-[(4-fluorophenyl)methyl]-4-hydroxy-6-methyl-2-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 54679961 |
| Molecular Formula | C18H14FNO4 |
| Molecular Weight | 327.31 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-4-hydroxy-6-methyl-2-oxoquinoline-3-carboxylic acid |
| SMILES | Cc1ccc2c(c1)c(O)c(C(=O)O)c(=O)n2Cc1ccc(F)cc1 |
| InChI | InChI=1S/C18H14FNO4/c1-10-2-7-14-13(8-10)16(21)15(18(23)24)17(22)20(14)9-11-3-5-12(19)6-4-11/h2-8,21H,9H2,1H3,(H,23,24) |
| InChIKey | UWVDAHLESMIXNO-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.31 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |