C17H13ClN2O3 — CID 141191896
4-chloro-6-methyl-2-oxo-1-(pyridin-2-ylmethyl)quinoline-3-carboxylic acid (PubChem CID 141191896) has the molecular formula C17H13ClN2O3 and a molecular weight of 328.76 g/mol. Its IUPAC name is 4-chloro-6-methyl-2-oxo-1-(pyridin-2-ylmethyl)quinoline-3-carboxylic acid.
| Compound Name | 4-chloro-6-methyl-2-oxo-1-(pyridin-2-ylmethyl)quinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 141191896 |
| Molecular Formula | C17H13ClN2O3 |
| Molecular Weight | 328.76 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | 4-chloro-6-methyl-2-oxo-1-(pyridin-2-ylmethyl)quinoline-3-carboxylic acid |
| SMILES | Cc1ccc2c(c1)c(Cl)c(C(=O)O)c(=O)n2Cc1ccccn1 |
| InChI | InChI=1S/C17H13ClN2O3/c1-10-5-6-13-12(8-10)15(18)14(17(22)23)16(21)20(13)9-11-4-2-3-7-19-11/h2-8H,9H2,1H3,(H,22,23) |
| InChIKey | WTIKPUIWTJTGQB-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.76 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |