C26H27N3O — CID 42162824
7-methyl-3-[[methyl(2-phenylethyl)amino]methyl]-1-(pyridin-2-ylmethyl)quinolin-2-one (PubChem CID 42162824) has the molecular formula C26H27N3O and a molecular weight of 397.52 g/mol. Its IUPAC name is 7-methyl-3-[[methyl(2-phenylethyl)amino]methyl]-1-(pyridin-2-ylmethyl)quinolin-2-one.
| Compound Name | 7-methyl-3-[[methyl(2-phenylethyl)amino]methyl]-1-(pyridin-2-ylmethyl)quinolin-2-one |
|---|---|
| PubChem CID | 42162824 |
| Molecular Formula | C26H27N3O |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.22 |
| IUPAC Name | 7-methyl-3-[[methyl(2-phenylethyl)amino]methyl]-1-(pyridin-2-ylmethyl)quinolin-2-one |
| SMILES | Cc1ccc2cc(CN(C)CCc3ccccc3)c(=O)n(Cc3ccccn3)c2c1 |
| InChI | InChI=1S/C26H27N3O/c1-20-11-12-22-17-23(18-28(2)15-13-21-8-4-3-5-9-21)26(30)29(25(22)16-20)19-24-10-6-7-14-27-24/h3-12,14,16-17H,13,15,18-19H2,1-2H3 |
| InChIKey | IZQVXALRQFEYBI-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |