C16H14N4O4 — CID 95917303
methyl 2-(3-benzyl-2,4-dioxopteridin-1-yl)acetate (PubChem CID 95917303) has the molecular formula C16H14N4O4 and a molecular weight of 326.31 g/mol. Its IUPAC name is methyl 2-(3-benzyl-2,4-dioxopteridin-1-yl)acetate.
| Compound Name | methyl 2-(3-benzyl-2,4-dioxopteridin-1-yl)acetate |
|---|---|
| PubChem CID | 95917303 |
| Molecular Formula | C16H14N4O4 |
| Molecular Weight | 326.31 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | methyl 2-(3-benzyl-2,4-dioxopteridin-1-yl)acetate |
| SMILES | COC(=O)Cn1c(=O)n(Cc2ccccc2)c(=O)c2nccnc21 |
| InChI | InChI=1S/C16H14N4O4/c1-24-12(21)10-19-14-13(17-7-8-18-14)15(22)20(16(19)23)9-11-5-3-2-4-6-11/h2-8H,9-10H2,1H3 |
| InChIKey | ZXQAXJGJGRPIKU-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 96.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.31 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |