C20H16N4O2 — CID 13328593
1,3-dibenzylpteridine-2,4-dione (PubChem CID 13328593) has the molecular formula C20H16N4O2 and a molecular weight of 344.37 g/mol. Its IUPAC name is 1,3-dibenzylpteridine-2,4-dione.
| Compound Name | 1,3-dibenzylpteridine-2,4-dione |
|---|---|
| PubChem CID | 13328593 |
| Molecular Formula | C20H16N4O2 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 1,3-dibenzylpteridine-2,4-dione |
| SMILES | O=c1c2nccnc2n(Cc2ccccc2)c(=O)n1Cc1ccccc1 |
| InChI | InChI=1S/C20H16N4O2/c25-19-17-18(22-12-11-21-17)23(13-15-7-3-1-4-8-15)20(26)24(19)14-16-9-5-2-6-10-16/h1-12H,13-14H2 |
| InChIKey | XAMSGIFQABBGFO-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 69.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |