C22H19N3O2 — CID 41233408
3-benzyl-1-(2-phenylethyl)pyrido[3,2-d]pyrimidine-2,4-dione (PubChem CID 41233408) has the molecular formula C22H19N3O2 and a molecular weight of 357.41 g/mol. Its IUPAC name is 3-benzyl-1-(2-phenylethyl)pyrido[3,2-d]pyrimidine-2,4-dione.
| Compound Name | 3-benzyl-1-(2-phenylethyl)pyrido[3,2-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 41233408 |
| Molecular Formula | C22H19N3O2 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | 3-benzyl-1-(2-phenylethyl)pyrido[3,2-d]pyrimidine-2,4-dione |
| SMILES | O=c1c2ncccc2n(CCc2ccccc2)c(=O)n1Cc1ccccc1 |
| InChI | InChI=1S/C22H19N3O2/c26-21-20-19(12-7-14-23-20)24(15-13-17-8-3-1-4-9-17)22(27)25(21)16-18-10-5-2-6-11-18/h1-12,14H,13,15-16H2 |
| InChIKey | KJYOEXSAQBHCKN-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 56.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |