C23H21N5O4 — CID 53062936
2-[2,4-dioxo-3-(2-phenylethyl)pteridin-1-yl]-N-(4-methoxyphenyl)acetamide (PubChem CID 53062936) has the molecular formula C23H21N5O4 and a molecular weight of 431.45 g/mol. Its IUPAC name is 2-[2,4-dioxo-3-(2-phenylethyl)pteridin-1-yl]-N-(4-methoxyphenyl)acetamide.
| Compound Name | 2-[2,4-dioxo-3-(2-phenylethyl)pteridin-1-yl]-N-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 53062936 |
| Molecular Formula | C23H21N5O4 |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | 2-[2,4-dioxo-3-(2-phenylethyl)pteridin-1-yl]-N-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)Cn2c(=O)n(CCc3ccccc3)c(=O)c3nccnc32)cc1 |
| InChI | InChI=1S/C23H21N5O4/c1-32-18-9-7-17(8-10-18)26-19(29)15-28-21-20(24-12-13-25-21)22(30)27(23(28)31)14-11-16-5-3-2-4-6-16/h2-10,12-13H,11,14-15H2,1H3,(H,26,29) |
| InChIKey | ZHCJOWLLHNYWSR-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 108.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |