C22H17F2N5O3 — CID 53062935
N-(3,4-difluorophenyl)-2-[2,4-dioxo-3-(2-phenylethyl)pteridin-1-yl]acetamide (PubChem CID 53062935) has the molecular formula C22H17F2N5O3 and a molecular weight of 437.41 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-2-[2,4-dioxo-3-(2-phenylethyl)pteridin-1-yl]acetamide.
| Compound Name | N-(3,4-difluorophenyl)-2-[2,4-dioxo-3-(2-phenylethyl)pteridin-1-yl]acetamide |
|---|---|
| PubChem CID | 53062935 |
| Molecular Formula | C22H17F2N5O3 |
| Molecular Weight | 437.41 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | N-(3,4-difluorophenyl)-2-[2,4-dioxo-3-(2-phenylethyl)pteridin-1-yl]acetamide |
| SMILES | O=C(Cn1c(=O)n(CCc2ccccc2)c(=O)c2nccnc21)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C22H17F2N5O3/c23-16-7-6-15(12-17(16)24)27-18(30)13-29-20-19(25-9-10-26-20)21(31)28(22(29)32)11-8-14-4-2-1-3-5-14/h1-7,9-10,12H,8,11,13H2,(H,27,30) |
| InChIKey | AYEKIEMTWXNDEH-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 98.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.41 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |