C23H20BrN5O3 — CID 53062947
N-(4-bromo-3-methylphenyl)-2-[2,4-dioxo-3-(2-phenylethyl)pteridin-1-yl]acetamide (PubChem CID 53062947) has the molecular formula C23H20BrN5O3 and a molecular weight of 494.35 g/mol. Its IUPAC name is N-(4-bromo-3-methylphenyl)-2-[2,4-dioxo-3-(2-phenylethyl)pteridin-1-yl]acetamide.
| Compound Name | N-(4-bromo-3-methylphenyl)-2-[2,4-dioxo-3-(2-phenylethyl)pteridin-1-yl]acetamide |
|---|---|
| PubChem CID | 53062947 |
| Molecular Formula | C23H20BrN5O3 |
| Molecular Weight | 494.35 g/mol |
| Exact Mass | 493.07 |
| IUPAC Name | N-(4-bromo-3-methylphenyl)-2-[2,4-dioxo-3-(2-phenylethyl)pteridin-1-yl]acetamide |
| SMILES | Cc1cc(NC(=O)Cn2c(=O)n(CCc3ccccc3)c(=O)c3nccnc32)ccc1Br |
| InChI | InChI=1S/C23H20BrN5O3/c1-15-13-17(7-8-18(15)24)27-19(30)14-29-21-20(25-10-11-26-21)22(31)28(23(29)32)12-9-16-5-3-2-4-6-16/h2-8,10-11,13H,9,12,14H2,1H3,(H,27,30) |
| InChIKey | BGVTXULHVPPIMC-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 98.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.35 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |