C24H23N5O5 — CID 53062932
N-(2,4-dimethoxyphenyl)-2-[2,4-dioxo-3-(2-phenylethyl)pteridin-1-yl]acetamide (PubChem CID 53062932) has the molecular formula C24H23N5O5 and a molecular weight of 461.48 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-2-[2,4-dioxo-3-(2-phenylethyl)pteridin-1-yl]acetamide.
| Compound Name | N-(2,4-dimethoxyphenyl)-2-[2,4-dioxo-3-(2-phenylethyl)pteridin-1-yl]acetamide |
|---|---|
| PubChem CID | 53062932 |
| Molecular Formula | C24H23N5O5 |
| Molecular Weight | 461.48 g/mol |
| Exact Mass | 461.17 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-2-[2,4-dioxo-3-(2-phenylethyl)pteridin-1-yl]acetamide |
| SMILES | COc1ccc(NC(=O)Cn2c(=O)n(CCc3ccccc3)c(=O)c3nccnc32)c(OC)c1 |
| InChI | InChI=1S/C24H23N5O5/c1-33-17-8-9-18(19(14-17)34-2)27-20(30)15-29-22-21(25-11-12-26-22)23(31)28(24(29)32)13-10-16-6-4-3-5-7-16/h3-9,11-12,14H,10,13,15H2,1-2H3,(H,27,30) |
| InChIKey | VWHPUETZCAQLGZ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 117.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.48 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |