About methyl 1-[1-(4-bromobutyl)-2,4-dioxoquinazolin-3-yl]cyclopentane-1-carboxylate
methyl 1-[1-(4-bromobutyl)-2,4-dioxoquinazolin-3-yl]cyclopentane-1-carboxylate (PubChem CID 22449627) has the molecular formula C19H23BrN2O4
and a molecular weight of 423.31 g/mol. Its IUPAC name is methyl 1-[1-(4-bromobutyl)-2,4-dioxoquinazolin-3-yl]cyclopentane-1-carboxylate.
Molecular Properties
| Compound Name | methyl 1-[1-(4-bromobutyl)-2,4-dioxoquinazolin-3-yl]cyclopentane-1-carboxylate |
| PubChem CID | 22449627 |
| Molecular Formula | C19H23BrN2O4 |
| Molecular Weight | 423.31 g/mol |
| Exact Mass | 422.08 |
| IUPAC Name | methyl 1-[1-(4-bromobutyl)-2,4-dioxoquinazolin-3-yl]cyclopentane-1-carboxylate |
| SMILES | COC(=O)C1(n2c(=O)c3ccccc3n(CCCCBr)c2=O)CCCC1 |
| InChI | InChI=1S/C19H23BrN2O4/c1-26-17(24)19(10-4-5-11-19)22-16(23)14-8-2-3-9-15(14)21(18(22)25)13-7-6-12-20/h2-3,8-9H,4-7,10-13H2,1H3 |
| InChIKey | ICGVAUFHKWCMNF-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 70.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 423.31 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze methyl 1-[1-(4-bromobutyl)-2,4-dioxoquinazolin-3-yl]cyclopentane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-[1-(4-bromobutyl)-2,4-dioxoquinazolin-3-yl]cyclopentane-1-carboxylate?
The IUPAC name of methyl 1-[1-(4-bromobutyl)-2,4-dioxoquinazolin-3-yl]cyclopentane-1-carboxylate (CID 22449627) is methyl 1-[1-(4-bromobutyl)-2,4-dioxoquinazolin-3-yl]cyclopentane-1-carboxylate.
What is the SMILES notation for methyl 1-[1-(4-bromobutyl)-2,4-dioxoquinazolin-3-yl]cyclopentane-1-carboxylate?
The canonical SMILES for methyl 1-[1-(4-bromobutyl)-2,4-dioxoquinazolin-3-yl]cyclopentane-1-carboxylate is COC(=O)C1(n2c(=O)c3ccccc3n(CCCCBr)c2=O)CCCC1.
What is the InChIKey of methyl 1-[1-(4-bromobutyl)-2,4-dioxoquinazolin-3-yl]cyclopentane-1-carboxylate?
The InChIKey is ICGVAUFHKWCMNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23BrN2O4/c1-26-17(24)19(10-4-5-11-19)22-16(23)14-8-2-3-9-15(14)21(18(22)25)13-7-6-12-20/h2-3,8-9H,4-7,10-13H2,1H3.
What are the key properties of methyl 1-[1-(4-bromobutyl)-2,4-dioxoquinazolin-3-yl]cyclopentane-1-carboxylate?
methyl 1-[1-(4-bromobutyl)-2,4-dioxoquinazolin-3-yl]cyclopentane-1-carboxylate has a molecular weight of 423.31 g/mol, XLogP of 2.78, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-[1-(4-bromobutyl)-2,4-dioxoquinazolin-3-yl]cyclopentane-1-carboxylate is sourced from PubChem (CID 22449627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).