C18H17BrN2O2 — CID 22449673
1-(4-bromobutyl)-3-phenylquinazoline-2,4-dione (PubChem CID 22449673) has the molecular formula C18H17BrN2O2 and a molecular weight of 373.25 g/mol. Its IUPAC name is 1-(4-bromobutyl)-3-phenylquinazoline-2,4-dione.
| Compound Name | 1-(4-bromobutyl)-3-phenylquinazoline-2,4-dione |
|---|---|
| PubChem CID | 22449673 |
| Molecular Formula | C18H17BrN2O2 |
| Molecular Weight | 373.25 g/mol |
| Exact Mass | 372.05 |
| IUPAC Name | 1-(4-bromobutyl)-3-phenylquinazoline-2,4-dione |
| SMILES | O=c1c2ccccc2n(CCCCBr)c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C18H17BrN2O2/c19-12-6-7-13-20-16-11-5-4-10-15(16)17(22)21(18(20)23)14-8-2-1-3-9-14/h1-5,8-11H,6-7,12-13H2 |
| InChIKey | BPUZJRBMMWHSNU-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.25 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|