C16H10Cl2N2O4 — CID 14458947
2-[3-(3,4-dichlorophenyl)-2,4-dioxoquinazolin-1-yl]acetic acid (PubChem CID 14458947) has the molecular formula C16H10Cl2N2O4 and a molecular weight of 365.17 g/mol. Its IUPAC name is 2-[3-(3,4-dichlorophenyl)-2,4-dioxoquinazolin-1-yl]acetic acid.
| Compound Name | 2-[3-(3,4-dichlorophenyl)-2,4-dioxoquinazolin-1-yl]acetic acid |
|---|---|
| PubChem CID | 14458947 |
| Molecular Formula | C16H10Cl2N2O4 |
| Molecular Weight | 365.17 g/mol |
| Exact Mass | 364.00 |
| IUPAC Name | 2-[3-(3,4-dichlorophenyl)-2,4-dioxoquinazolin-1-yl]acetic acid |
| SMILES | O=C(O)Cn1c(=O)n(-c2ccc(Cl)c(Cl)c2)c(=O)c2ccccc21 |
| InChI | InChI=1S/C16H10Cl2N2O4/c17-11-6-5-9(7-12(11)18)20-15(23)10-3-1-2-4-13(10)19(16(20)24)8-14(21)22/h1-7H,8H2,(H,21,22) |
| InChIKey | IRJWVIIDKZJNND-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 81.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.17 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |