C21H14Cl2N2O2 — CID 17147919
3-(3-chlorophenyl)-1-[(2-chlorophenyl)methyl]quinazoline-2,4-dione (PubChem CID 17147919) has the molecular formula C21H14Cl2N2O2 and a molecular weight of 397.26 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-1-[(2-chlorophenyl)methyl]quinazoline-2,4-dione.
| Compound Name | 3-(3-chlorophenyl)-1-[(2-chlorophenyl)methyl]quinazoline-2,4-dione |
|---|---|
| PubChem CID | 17147919 |
| Molecular Formula | C21H14Cl2N2O2 |
| Molecular Weight | 397.26 g/mol |
| Exact Mass | 396.04 |
| IUPAC Name | 3-(3-chlorophenyl)-1-[(2-chlorophenyl)methyl]quinazoline-2,4-dione |
| SMILES | O=c1c2ccccc2n(Cc2ccccc2Cl)c(=O)n1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C21H14Cl2N2O2/c22-15-7-5-8-16(12-15)25-20(26)17-9-2-4-11-19(17)24(21(25)27)13-14-6-1-3-10-18(14)23/h1-12H,13H2 |
| InChIKey | AGSHVEDLPCIZKZ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.26 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |