C24H20ClN3O3 — CID 93301719
2-[3-(3-chlorophenyl)-2,4-dioxoquinazolin-1-yl]-N-[(1R)-1-phenylethyl]acetamide (PubChem CID 93301719) has the molecular formula C24H20ClN3O3 and a molecular weight of 433.90 g/mol. Its IUPAC name is 2-[3-(3-chlorophenyl)-2,4-dioxoquinazolin-1-yl]-N-[(1R)-1-phenylethyl]acetamide.
| Compound Name | 2-[3-(3-chlorophenyl)-2,4-dioxoquinazolin-1-yl]-N-[(1R)-1-phenylethyl]acetamide |
|---|---|
| PubChem CID | 93301719 |
| Molecular Formula | C24H20ClN3O3 |
| Molecular Weight | 433.90 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | 2-[3-(3-chlorophenyl)-2,4-dioxoquinazolin-1-yl]-N-[(1R)-1-phenylethyl]acetamide |
| SMILES | C[C@@H](NC(=O)Cn1c(=O)n(-c2cccc(Cl)c2)c(=O)c2ccccc21)c1ccccc1 |
| InChI | InChI=1S/C24H20ClN3O3/c1-16(17-8-3-2-4-9-17)26-22(29)15-27-21-13-6-5-12-20(21)23(30)28(24(27)31)19-11-7-10-18(25)14-19/h2-14,16H,15H2,1H3,(H,26,29)/t16-/m1/s1 |
| InChIKey | RBVWEJSDJLFCLC-MRXNPFEDSA-N |
| XLogP | 3.68 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.90 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |