C20H21N3O4 — CID 42810869
2-[3-(4-methoxyphenyl)-2,4-dioxoquinazolin-1-yl]-N-propan-2-ylacetamide (PubChem CID 42810869) has the molecular formula C20H21N3O4 and a molecular weight of 367.41 g/mol. Its IUPAC name is 2-[3-(4-methoxyphenyl)-2,4-dioxoquinazolin-1-yl]-N-propan-2-ylacetamide.
| Compound Name | 2-[3-(4-methoxyphenyl)-2,4-dioxoquinazolin-1-yl]-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 42810869 |
| Molecular Formula | C20H21N3O4 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | 2-[3-(4-methoxyphenyl)-2,4-dioxoquinazolin-1-yl]-N-propan-2-ylacetamide |
| SMILES | COc1ccc(-n2c(=O)c3ccccc3n(CC(=O)NC(C)C)c2=O)cc1 |
| InChI | InChI=1S/C20H21N3O4/c1-13(2)21-18(24)12-22-17-7-5-4-6-16(17)19(25)23(20(22)26)14-8-10-15(27-3)11-9-14/h4-11,13H,12H2,1-3H3,(H,21,24) |
| InChIKey | HPKDMWZUNKUKOE-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 82.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |