C23H18ClN3O4 — CID 42811337
2-[3-(2-chlorophenyl)-2,4-dioxoquinazolin-1-yl]-N-(4-methoxyphenyl)acetamide (PubChem CID 42811337) has the molecular formula C23H18ClN3O4 and a molecular weight of 435.87 g/mol. Its IUPAC name is 2-[3-(2-chlorophenyl)-2,4-dioxoquinazolin-1-yl]-N-(4-methoxyphenyl)acetamide.
| Compound Name | 2-[3-(2-chlorophenyl)-2,4-dioxoquinazolin-1-yl]-N-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 42811337 |
| Molecular Formula | C23H18ClN3O4 |
| Molecular Weight | 435.87 g/mol |
| Exact Mass | 435.10 |
| IUPAC Name | 2-[3-(2-chlorophenyl)-2,4-dioxoquinazolin-1-yl]-N-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)Cn2c(=O)n(-c3ccccc3Cl)c(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C23H18ClN3O4/c1-31-16-12-10-15(11-13-16)25-21(28)14-26-19-8-4-2-6-17(19)22(29)27(23(26)30)20-9-5-3-7-18(20)24/h2-13H,14H2,1H3,(H,25,28) |
| InChIKey | NJHHXOQZPVZFNU-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 82.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.87 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |