C18H17N3O4 — CID 24718369
2-[3-(4-methoxyphenyl)-2,4-dioxoquinazolin-1-yl]propanamide (PubChem CID 24718369) has the molecular formula C18H17N3O4 and a molecular weight of 339.35 g/mol. Its IUPAC name is 2-[3-(4-methoxyphenyl)-2,4-dioxoquinazolin-1-yl]propanamide.
| Compound Name | 2-[3-(4-methoxyphenyl)-2,4-dioxoquinazolin-1-yl]propanamide |
|---|---|
| PubChem CID | 24718369 |
| Molecular Formula | C18H17N3O4 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | 2-[3-(4-methoxyphenyl)-2,4-dioxoquinazolin-1-yl]propanamide |
| SMILES | COc1ccc(-n2c(=O)c3ccccc3n(C(C)C(N)=O)c2=O)cc1 |
| InChI | InChI=1S/C18H17N3O4/c1-11(16(19)22)20-15-6-4-3-5-14(15)17(23)21(18(20)24)12-7-9-13(25-2)10-8-12/h3-11H,1-2H3,(H2,19,22) |
| InChIKey | IIPNEOZOSRFGCJ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 96.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |