C18H15ClN2O5 — CID 42810737
2-[7-chloro-3-(4-methoxyphenyl)-2,4-dioxoquinazolin-1-yl]propanoic acid (PubChem CID 42810737) has the molecular formula C18H15ClN2O5 and a molecular weight of 374.78 g/mol. Its IUPAC name is 2-[7-chloro-3-(4-methoxyphenyl)-2,4-dioxoquinazolin-1-yl]propanoic acid.
| Compound Name | 2-[7-chloro-3-(4-methoxyphenyl)-2,4-dioxoquinazolin-1-yl]propanoic acid |
|---|---|
| PubChem CID | 42810737 |
| Molecular Formula | C18H15ClN2O5 |
| Molecular Weight | 374.78 g/mol |
| Exact Mass | 374.07 |
| IUPAC Name | 2-[7-chloro-3-(4-methoxyphenyl)-2,4-dioxoquinazolin-1-yl]propanoic acid |
| SMILES | COc1ccc(-n2c(=O)c3ccc(Cl)cc3n(C(C)C(=O)O)c2=O)cc1 |
| InChI | InChI=1S/C18H15ClN2O5/c1-10(17(23)24)20-15-9-11(19)3-8-14(15)16(22)21(18(20)25)12-4-6-13(26-2)7-5-12/h3-10H,1-2H3,(H,23,24) |
| InChIKey | URKVHDCGZQDFOF-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 90.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.78 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |