C18H16N2O4 — CID 93142932
(2R)-2-[3-(3-methylphenyl)-2,4-dioxoquinazolin-1-yl]propanoic acid (PubChem CID 93142932) has the molecular formula C18H16N2O4 and a molecular weight of 324.34 g/mol. Its IUPAC name is (2R)-2-[3-(3-methylphenyl)-2,4-dioxoquinazolin-1-yl]propanoic acid.
| Compound Name | (2R)-2-[3-(3-methylphenyl)-2,4-dioxoquinazolin-1-yl]propanoic acid |
|---|---|
| PubChem CID | 93142932 |
| Molecular Formula | C18H16N2O4 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | (2R)-2-[3-(3-methylphenyl)-2,4-dioxoquinazolin-1-yl]propanoic acid |
| SMILES | Cc1cccc(-n2c(=O)c3ccccc3n([C@H](C)C(=O)O)c2=O)c1 |
| InChI | InChI=1S/C18H16N2O4/c1-11-6-5-7-13(10-11)20-16(21)14-8-3-4-9-15(14)19(18(20)24)12(2)17(22)23/h3-10,12H,1-2H3,(H,22,23)/t12-/m1/s1 |
| InChIKey | PBMMHYZPZPJKLU-GFCCVEGCSA-N |
| XLogP | 2.11 |
| TPSA | 81.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |