C25H21N3O5 — CID 175872723
N-hydroxy-3-[4-[[3-(4-methoxyphenyl)-2,4-dioxoquinazolin-1-yl]methyl]phenyl]prop-2-enamide (PubChem CID 175872723) has the molecular formula C25H21N3O5 and a molecular weight of 443.46 g/mol. Its IUPAC name is N-hydroxy-3-[4-[[3-(4-methoxyphenyl)-2,4-dioxoquinazolin-1-yl]methyl]phenyl]prop-2-enamide.
| Compound Name | N-hydroxy-3-[4-[[3-(4-methoxyphenyl)-2,4-dioxoquinazolin-1-yl]methyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 175872723 |
| Molecular Formula | C25H21N3O5 |
| Molecular Weight | 443.46 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | N-hydroxy-3-[4-[[3-(4-methoxyphenyl)-2,4-dioxoquinazolin-1-yl]methyl]phenyl]prop-2-enamide |
| SMILES | COc1ccc(-n2c(=O)c3ccccc3n(Cc3ccc(C=CC(=O)NO)cc3)c2=O)cc1 |
| InChI | InChI=1S/C25H21N3O5/c1-33-20-13-11-19(12-14-20)28-24(30)21-4-2-3-5-22(21)27(25(28)31)16-18-8-6-17(7-9-18)10-15-23(29)26-32/h2-15,32H,16H2,1H3,(H,26,29) |
| InChIKey | RKNWMKJUIDEWIU-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 102.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.46 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|