C27H22Cl2N4O4 — CID 3544064
N-[2-[[1-[(3,4-dichlorophenyl)methyl]-2-hydroxyindol-3-yl]diazenyl]-2-oxoethyl]-3-(4-methoxyphenyl)prop-2-enamide (PubChem CID 3544064) has the molecular formula C27H22Cl2N4O4 and a molecular weight of 537.40 g/mol. Its IUPAC name is N-[2-[[1-[(3,4-dichlorophenyl)methyl]-2-hydroxyindol-3-yl]diazenyl]-2-oxoethyl]-3-(4-methoxyphenyl)prop-2-enamide.
| Compound Name | N-[2-[[1-[(3,4-dichlorophenyl)methyl]-2-hydroxyindol-3-yl]diazenyl]-2-oxoethyl]-3-(4-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 3544064 |
| Molecular Formula | C27H22Cl2N4O4 |
| Molecular Weight | 537.40 g/mol |
| Exact Mass | 536.10 |
| IUPAC Name | N-[2-[[1-[(3,4-dichlorophenyl)methyl]-2-hydroxyindol-3-yl]diazenyl]-2-oxoethyl]-3-(4-methoxyphenyl)prop-2-enamide |
| SMILES | COc1ccc(C=CC(=O)NCC(=O)/N=N/c2c(O)n(Cc3ccc(Cl)c(Cl)c3)c3ccccc23)cc1 |
| InChI | InChI=1S/C27H22Cl2N4O4/c1-37-19-10-6-17(7-11-19)9-13-24(34)30-15-25(35)31-32-26-20-4-2-3-5-23(20)33(27(26)36)16-18-8-12-21(28)22(29)14-18/h2-14,36H,15-16H2,1H3,(H,30,34)/b13-9?,32-31+ |
| InChIKey | DMNWEGVVBWXEAX-DUGYAWCBSA-N |
| XLogP | 6.15 |
| TPSA | 105.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.40 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|