C21H20N4O4 — CID 3712818
N-[2-[(2-hydroxy-1-methylindol-3-yl)diazenyl]-2-oxoethyl]-3-(2-methoxyphenyl)prop-2-enamide (PubChem CID 3712818) has the molecular formula C21H20N4O4 and a molecular weight of 392.42 g/mol. Its IUPAC name is N-[2-[(2-hydroxy-1-methylindol-3-yl)diazenyl]-2-oxoethyl]-3-(2-methoxyphenyl)prop-2-enamide.
| Compound Name | N-[2-[(2-hydroxy-1-methylindol-3-yl)diazenyl]-2-oxoethyl]-3-(2-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 3712818 |
| Molecular Formula | C21H20N4O4 |
| Molecular Weight | 392.42 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | N-[2-[(2-hydroxy-1-methylindol-3-yl)diazenyl]-2-oxoethyl]-3-(2-methoxyphenyl)prop-2-enamide |
| SMILES | COc1ccccc1C=CC(=O)NCC(=O)/N=N/c1c(O)n(C)c2ccccc12 |
| InChI | InChI=1S/C21H20N4O4/c1-25-16-9-5-4-8-15(16)20(21(25)28)24-23-19(27)13-22-18(26)12-11-14-7-3-6-10-17(14)29-2/h3-12,28H,13H2,1-2H3,(H,22,26)/b12-11?,24-23+ |
| InChIKey | SRKUQOFZZPAHMP-QLWMDKSKSA-N |
| XLogP | 3.33 |
| TPSA | 105.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.42 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|