C20H20N4O4 — CID 3785636
3-(furan-2-yl)-N-[2-[(2-hydroxy-1-propylindol-3-yl)diazenyl]-2-oxoethyl]prop-2-enamide (PubChem CID 3785636) has the molecular formula C20H20N4O4 and a molecular weight of 380.40 g/mol. Its IUPAC name is 3-(furan-2-yl)-N-[2-[(2-hydroxy-1-propylindol-3-yl)diazenyl]-2-oxoethyl]prop-2-enamide.
| Compound Name | 3-(furan-2-yl)-N-[2-[(2-hydroxy-1-propylindol-3-yl)diazenyl]-2-oxoethyl]prop-2-enamide |
|---|---|
| PubChem CID | 3785636 |
| Molecular Formula | C20H20N4O4 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | 3-(furan-2-yl)-N-[2-[(2-hydroxy-1-propylindol-3-yl)diazenyl]-2-oxoethyl]prop-2-enamide |
| SMILES | CCCn1c(O)c(/N=N/C(=O)CNC(=O)C=Cc2ccco2)c2ccccc21 |
| InChI | InChI=1S/C20H20N4O4/c1-2-11-24-16-8-4-3-7-15(16)19(20(24)27)23-22-18(26)13-21-17(25)10-9-14-6-5-12-28-14/h3-10,12,27H,2,11,13H2,1H3,(H,21,25)/b10-9?,23-22+ |
| InChIKey | ZQYFSRYLOJFLQX-MTRWZJRTSA-N |
| XLogP | 3.79 |
| TPSA | 109.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|