C28H34N10O6 — CID 135810850
N,N'-bis[(2-hydroxy-1-propylindol-3-yl)imino]propanediamide;propanedihydrazide (PubChem CID 135810850) has the molecular formula C28H34N10O6 and a molecular weight of 606.64 g/mol. Its IUPAC name is N,N'-bis[(2-hydroxy-1-propylindol-3-yl)imino]propanediamide;propanedihydrazide.
| Compound Name | N,N'-bis[(2-hydroxy-1-propylindol-3-yl)imino]propanediamide;propanedihydrazide |
|---|---|
| PubChem CID | 135810850 |
| Molecular Formula | C28H34N10O6 |
| Molecular Weight | 606.64 g/mol |
| Exact Mass | 606.27 |
| IUPAC Name | N,N'-bis[(2-hydroxy-1-propylindol-3-yl)imino]propanediamide;propanedihydrazide |
| SMILES | CCCn1c(O)c(/N=N/C(=O)CC(=O)/N=N/c2c(O)n(CCC)c3ccccc23)c2ccccc21.NNC(=O)CC(=O)NN |
| InChI | InChI=1S/C25H26N6O4.C3H8N4O2/c1-3-13-30-18-11-7-5-9-16(18)22(24(30)34)28-26-20(32)15-21(33)27-29-23-17-10-6-8-12-19(17)31(14-4-2)25(23)35;4-6-2(8)1-3(9)7-5/h5-12,34-35H,3-4,13-15H2,1-2H3;1,4-5H2,(H,6,8)(H,7,9)/b28-26+,29-27+; |
| InChIKey | LMEKEYMJLOTXRL-JBQZZDHSSA-N |
| XLogP | 3.49 |
| TPSA | 244.14 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.64 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|