C13H18N5O+ — CID 135754966
[amino-[(1-butyl-2-hydroxyindol-3-yl)diazenyl]methylidene]azanium (PubChem CID 135754966) has the molecular formula C13H18N5O+ and a molecular weight of 260.32 g/mol. Its IUPAC name is [amino-[(1-butyl-2-hydroxyindol-3-yl)diazenyl]methylidene]azanium.
| Compound Name | [amino-[(1-butyl-2-hydroxyindol-3-yl)diazenyl]methylidene]azanium |
|---|---|
| PubChem CID | 135754966 |
| Molecular Formula | C13H18N5O+ |
| Molecular Weight | 260.32 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | [amino-[(1-butyl-2-hydroxyindol-3-yl)diazenyl]methylidene]azanium |
| SMILES | CCCCn1c(O)c(/N=N/C(N)=[NH2+])c2ccccc21 |
| InChI | InChI=1S/C13H17N5O/c1-2-3-8-18-10-7-5-4-6-9(10)11(12(18)19)16-17-13(14)15/h4-7,19H,2-3,8H2,1H3,(H3,14,15)/p+1/b17-16+ |
| InChIKey | WEQCPEIPERSHKW-WUKNDPDISA-O |
| XLogP | 1.30 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.32 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|