C15H19N3O3 — CID 2692604
methyl N-(2-hydroxy-1-pentylindol-3-yl)iminocarbamate (PubChem CID 2692604) has the molecular formula C15H19N3O3 and a molecular weight of 289.34 g/mol. Its IUPAC name is methyl N-(2-hydroxy-1-pentylindol-3-yl)iminocarbamate.
| Compound Name | methyl N-(2-hydroxy-1-pentylindol-3-yl)iminocarbamate |
|---|---|
| PubChem CID | 2692604 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | methyl N-(2-hydroxy-1-pentylindol-3-yl)iminocarbamate |
| SMILES | CCCCCn1c(O)c(/N=N/C(=O)OC)c2ccccc21 |
| InChI | InChI=1S/C15H19N3O3/c1-3-4-7-10-18-12-9-6-5-8-11(12)13(14(18)19)16-17-15(20)21-2/h5-6,8-9,19H,3-4,7,10H2,1-2H3/b17-16+ |
| InChIKey | PILWAPNVQXXOOO-WUKNDPDISA-N |
| XLogP | 4.39 |
| TPSA | 76.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|