C19H27N3O3 — CID 135881483
tert-butyl N-(1-hexyl-2-hydroxyindol-3-yl)iminocarbamate (PubChem CID 135881483) has the molecular formula C19H27N3O3 and a molecular weight of 345.44 g/mol. Its IUPAC name is tert-butyl N-(1-hexyl-2-hydroxyindol-3-yl)iminocarbamate.
| Compound Name | tert-butyl N-(1-hexyl-2-hydroxyindol-3-yl)iminocarbamate |
|---|---|
| PubChem CID | 135881483 |
| Molecular Formula | C19H27N3O3 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | tert-butyl N-(1-hexyl-2-hydroxyindol-3-yl)iminocarbamate |
| SMILES | CCCCCCn1c(O)c(/N=N/C(=O)OC(C)(C)C)c2ccccc21 |
| InChI | InChI=1S/C19H27N3O3/c1-5-6-7-10-13-22-15-12-9-8-11-14(15)16(17(22)23)20-21-18(24)25-19(2,3)4/h8-9,11-12,23H,5-7,10,13H2,1-4H3/b21-20+ |
| InChIKey | UKMVZQFPQOXRJR-QZQOTICOSA-N |
| XLogP | 5.95 |
| TPSA | 76.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|