C24H21N3O3 — CID 1356442
N-(1-ethyl-2-hydroxyindol-3-yl)imino-2-hydroxy-2,2-diphenylacetamide (PubChem CID 1356442) has the molecular formula C24H21N3O3 and a molecular weight of 399.45 g/mol. Its IUPAC name is N-(1-ethyl-2-hydroxyindol-3-yl)imino-2-hydroxy-2,2-diphenylacetamide.
| Compound Name | N-(1-ethyl-2-hydroxyindol-3-yl)imino-2-hydroxy-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 1356442 |
| Molecular Formula | C24H21N3O3 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | N-(1-ethyl-2-hydroxyindol-3-yl)imino-2-hydroxy-2,2-diphenylacetamide |
| SMILES | CCn1c(O)c(/N=N/C(=O)C(O)(c2ccccc2)c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C24H21N3O3/c1-2-27-20-16-10-9-15-19(20)21(22(27)28)25-26-23(29)24(30,17-11-5-3-6-12-17)18-13-7-4-8-14-18/h3-16,28,30H,2H2,1H3/b26-25+ |
| InChIKey | QYRZMPYNXHHVKX-OCEACIFDSA-N |
| XLogP | 4.91 |
| TPSA | 87.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|