About N-(1-ethyl-2-hydroxyindol-3-yl)imino-3,5-dinitrobenzamide
N-(1-ethyl-2-hydroxyindol-3-yl)imino-3,5-dinitrobenzamide (PubChem CID 3522953) has the molecular formula C17H13N5O6
and a molecular weight of 383.32 g/mol. Its IUPAC name is N-(1-ethyl-2-hydroxyindol-3-yl)imino-3,5-dinitrobenzamide.
Molecular Properties
| Compound Name | N-(1-ethyl-2-hydroxyindol-3-yl)imino-3,5-dinitrobenzamide |
| PubChem CID | 3522953 |
| Molecular Formula | C17H13N5O6 |
| Molecular Weight | 383.32 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | N-(1-ethyl-2-hydroxyindol-3-yl)imino-3,5-dinitrobenzamide |
| SMILES | CCn1c(O)c(/N=N/C(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)c2ccccc21 |
| InChI | InChI=1S/C17H13N5O6/c1-2-20-14-6-4-3-5-13(14)15(17(20)24)18-19-16(23)10-7-11(21(25)26)9-12(8-10)22(27)28/h3-9,24H,2H2,1H3/b19-18+ |
| InChIKey | QGGUJZMPIKDEOC-VHEBQXMUSA-N |
| XLogP | 4.11 |
| TPSA | 153.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.32 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(1-ethyl-2-hydroxyindol-3-yl)imino-3,5-dinitrobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-ethyl-2-hydroxyindol-3-yl)imino-3,5-dinitrobenzamide?
The IUPAC name of N-(1-ethyl-2-hydroxyindol-3-yl)imino-3,5-dinitrobenzamide (CID 3522953) is N-(1-ethyl-2-hydroxyindol-3-yl)imino-3,5-dinitrobenzamide.
What is the SMILES notation for N-(1-ethyl-2-hydroxyindol-3-yl)imino-3,5-dinitrobenzamide?
The canonical SMILES for N-(1-ethyl-2-hydroxyindol-3-yl)imino-3,5-dinitrobenzamide is CCn1c(O)c(/N=N/C(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)c2ccccc21.
What is the InChIKey of N-(1-ethyl-2-hydroxyindol-3-yl)imino-3,5-dinitrobenzamide?
The InChIKey is QGGUJZMPIKDEOC-VHEBQXMUSA-N. The full InChI is InChI=1S/C17H13N5O6/c1-2-20-14-6-4-3-5-13(14)15(17(20)24)18-19-16(23)10-7-11(21(25)26)9-12(8-10)22(27)28/h3-9,24H,2H2,1H3/b19-18+.
What are the key properties of N-(1-ethyl-2-hydroxyindol-3-yl)imino-3,5-dinitrobenzamide?
N-(1-ethyl-2-hydroxyindol-3-yl)imino-3,5-dinitrobenzamide has a molecular weight of 383.32 g/mol, XLogP of 4.11, 5 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-ethyl-2-hydroxyindol-3-yl)imino-3,5-dinitrobenzamide is sourced from PubChem (CID 3522953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).