C24H19N5O5 — CID 1048808
N-[2-hydroxy-1-[2-(4-methylanilino)-2-oxoethyl]indol-3-yl]imino-4-nitrobenzamide (PubChem CID 1048808) has the molecular formula C24H19N5O5 and a molecular weight of 457.45 g/mol. Its IUPAC name is N-[2-hydroxy-1-[2-(4-methylanilino)-2-oxoethyl]indol-3-yl]imino-4-nitrobenzamide.
| Compound Name | N-[2-hydroxy-1-[2-(4-methylanilino)-2-oxoethyl]indol-3-yl]imino-4-nitrobenzamide |
|---|---|
| PubChem CID | 1048808 |
| Molecular Formula | C24H19N5O5 |
| Molecular Weight | 457.45 g/mol |
| Exact Mass | 457.14 |
| IUPAC Name | N-[2-hydroxy-1-[2-(4-methylanilino)-2-oxoethyl]indol-3-yl]imino-4-nitrobenzamide |
| SMILES | Cc1ccc(NC(=O)Cn2c(O)c(/N=N/C(=O)c3ccc([N+](=O)[O-])cc3)c3ccccc32)cc1 |
| InChI | InChI=1S/C24H19N5O5/c1-15-6-10-17(11-7-15)25-21(30)14-28-20-5-3-2-4-19(20)22(24(28)32)26-27-23(31)16-8-12-18(13-9-16)29(33)34/h2-13,32H,14H2,1H3,(H,25,30)/b27-26+ |
| InChIKey | VYWJQBDIMDIYSV-CYYJNZCTSA-N |
| XLogP | 5.13 |
| TPSA | 139.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.45 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|