C17H16N6O2 — CID 2304852
2-[3-(carbamimidoyldiazenyl)-2-hydroxyindol-1-yl]-N-phenylacetamide (PubChem CID 2304852) has the molecular formula C17H16N6O2 and a molecular weight of 336.36 g/mol. Its IUPAC name is 2-[3-(carbamimidoyldiazenyl)-2-hydroxyindol-1-yl]-N-phenylacetamide.
| Compound Name | 2-[3-(carbamimidoyldiazenyl)-2-hydroxyindol-1-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 2304852 |
| Molecular Formula | C17H16N6O2 |
| Molecular Weight | 336.36 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | 2-[3-(carbamimidoyldiazenyl)-2-hydroxyindol-1-yl]-N-phenylacetamide |
| SMILES | [H]/N=C(N)/N=N/c1c(O)n(CC(=O)Nc2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C17H16N6O2/c18-17(19)22-21-15-12-8-4-5-9-13(12)23(16(15)25)10-14(24)20-11-6-2-1-3-7-11/h1-9,25H,10H2,(H3,18,19)(H,20,24)/b22-21+ |
| InChIKey | GMLRJIRZHISYDX-QURGRASLSA-N |
| XLogP | 2.96 |
| TPSA | 128.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.36 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|