C19H19N5O3 — CID 3375454
N'-[1-[(dimethylamino)methyl]-2-hydroxyindol-3-yl]imino-N-phenyloxamide (PubChem CID 3375454) has the molecular formula C19H19N5O3 and a molecular weight of 365.39 g/mol. Its IUPAC name is N'-[1-[(dimethylamino)methyl]-2-hydroxyindol-3-yl]imino-N-phenyloxamide.
| Compound Name | N'-[1-[(dimethylamino)methyl]-2-hydroxyindol-3-yl]imino-N-phenyloxamide |
|---|---|
| PubChem CID | 3375454 |
| Molecular Formula | C19H19N5O3 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | N'-[1-[(dimethylamino)methyl]-2-hydroxyindol-3-yl]imino-N-phenyloxamide |
| SMILES | CN(C)Cn1c(O)c(/N=N/C(=O)C(=O)Nc2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C19H19N5O3/c1-23(2)12-24-15-11-7-6-10-14(15)16(19(24)27)21-22-18(26)17(25)20-13-8-4-3-5-9-13/h3-11,27H,12H2,1-2H3,(H,20,25)/b22-21+ |
| InChIKey | WZDVTVSGFUBKAG-QURGRASLSA-N |
| XLogP | 3.12 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|