C19H28N5O3+ — CID 135575864
diethyl-[2-[2-hydroxy-3-[[2-oxo-2-(propan-2-ylamino)acetyl]diazenyl]indol-1-yl]ethyl]azanium (PubChem CID 135575864) has the molecular formula C19H28N5O3+ and a molecular weight of 374.47 g/mol. Its IUPAC name is diethyl-[2-[2-hydroxy-3-[[2-oxo-2-(propan-2-ylamino)acetyl]diazenyl]indol-1-yl]ethyl]azanium.
| Compound Name | diethyl-[2-[2-hydroxy-3-[[2-oxo-2-(propan-2-ylamino)acetyl]diazenyl]indol-1-yl]ethyl]azanium |
|---|---|
| PubChem CID | 135575864 |
| Molecular Formula | C19H28N5O3+ |
| Molecular Weight | 374.47 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | diethyl-[2-[2-hydroxy-3-[[2-oxo-2-(propan-2-ylamino)acetyl]diazenyl]indol-1-yl]ethyl]azanium |
| SMILES | CC[NH+](CC)CCn1c(O)c(/N=N/C(=O)C(=O)NC(C)C)c2ccccc21 |
| InChI | InChI=1S/C19H27N5O3/c1-5-23(6-2)11-12-24-15-10-8-7-9-14(15)16(19(24)27)21-22-18(26)17(25)20-13(3)4/h7-10,13,27H,5-6,11-12H2,1-4H3,(H,20,25)/p+1/b22-21+ |
| InChIKey | VQAFSHMNOJDMLR-QURGRASLSA-O |
| XLogP | 1.41 |
| TPSA | 100.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.47 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|