C19H27N4O4S+ — CID 135817887
2-[3-[[(3S)-1,1-dioxothiolane-3-carbonyl]diazenyl]-2-hydroxyindol-1-yl]ethyl-diethylazanium (PubChem CID 135817887) has the molecular formula C19H27N4O4S+ and a molecular weight of 407.52 g/mol. Its IUPAC name is 2-[3-[[(3S)-1,1-dioxothiolane-3-carbonyl]diazenyl]-2-hydroxyindol-1-yl]ethyl-diethylazanium.
| Compound Name | 2-[3-[[(3S)-1,1-dioxothiolane-3-carbonyl]diazenyl]-2-hydroxyindol-1-yl]ethyl-diethylazanium |
|---|---|
| PubChem CID | 135817887 |
| Molecular Formula | C19H27N4O4S+ |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | 2-[3-[[(3S)-1,1-dioxothiolane-3-carbonyl]diazenyl]-2-hydroxyindol-1-yl]ethyl-diethylazanium |
| SMILES | CC[NH+](CC)CCn1c(O)c(/N=N/C(=O)[C@@H]2CCS(=O)(=O)C2)c2ccccc21 |
| InChI | InChI=1S/C19H26N4O4S/c1-3-22(4-2)10-11-23-16-8-6-5-7-15(16)17(19(23)25)20-21-18(24)14-9-12-28(26,27)13-14/h5-8,14,25H,3-4,9-13H2,1-2H3/p+1/b21-20+/t14-/m1/s1 |
| InChIKey | ZTAFZXJYSZXFCK-YYZBOFOMSA-O |
| XLogP | 1.32 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|