C20H23F2N4O+ — CID 135734559
2-[3-[(2,4-difluorophenyl)diazenyl]-2-hydroxyindol-1-yl]ethyl-diethylazanium (PubChem CID 135734559) has the molecular formula C20H23F2N4O+ and a molecular weight of 373.43 g/mol. Its IUPAC name is 2-[3-[(2,4-difluorophenyl)diazenyl]-2-hydroxyindol-1-yl]ethyl-diethylazanium.
| Compound Name | 2-[3-[(2,4-difluorophenyl)diazenyl]-2-hydroxyindol-1-yl]ethyl-diethylazanium |
|---|---|
| PubChem CID | 135734559 |
| Molecular Formula | C20H23F2N4O+ |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | 2-[3-[(2,4-difluorophenyl)diazenyl]-2-hydroxyindol-1-yl]ethyl-diethylazanium |
| SMILES | CC[NH+](CC)CCn1c(O)c(/N=N/c2ccc(F)cc2F)c2ccccc21 |
| InChI | InChI=1S/C20H22F2N4O/c1-3-25(4-2)11-12-26-18-8-6-5-7-15(18)19(20(26)27)24-23-17-10-9-14(21)13-16(17)22/h5-10,13,27H,3-4,11-12H2,1-2H3/p+1/b24-23+ |
| InChIKey | NYJDYYGDFPODDA-WCWDXBQESA-O |
| XLogP | 3.97 |
| TPSA | 54.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|